C32H25ClN4O2S — CID 4173010
5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 4173010) has the molecular formula C32H25ClN4O2S and a molecular weight of 565.10 g/mol. Its IUPAC name is 5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 4173010 |
| Molecular Formula | C32H25ClN4O2S |
| Molecular Weight | 565.10 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-(4-methoxyphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2CC(c3c(-c4ccccc4)c4cc(Cl)ccc4[nH]c3=O)=NN2C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H25ClN4O2S/c1-39-24-15-12-20(13-16-24)28-19-27(36-37(28)32(40)34-23-10-6-3-7-11-23)30-29(21-8-4-2-5-9-21)25-18-22(33)14-17-26(25)35-31(30)38/h2-18,28H,19H2,1H3,(H,34,40)(H,35,38) |
| InChIKey | SVQPVXRHQGCUMY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.10 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|