C61H49O3P3 — CID 144803254
1,3-bis(4-diphenylphosphorylphenyl)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]phenyl]benzene (PubChem CID 144803254) has the molecular formula C61H49O3P3 and a molecular weight of 922.98 g/mol. Its IUPAC name is 1,3-bis(4-diphenylphosphorylphenyl)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]phenyl]benzene.
| Compound Name | 1,3-bis(4-diphenylphosphorylphenyl)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]phenyl]benzene |
|---|---|
| PubChem CID | 144803254 |
| Molecular Formula | C61H49O3P3 |
| Molecular Weight | 922.98 g/mol |
| Exact Mass | 922.29 |
| IUPAC Name | 1,3-bis(4-diphenylphosphorylphenyl)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]phenyl]benzene |
| SMILES | CC1C=CC(P(=O)(c2ccccc2)c2ccc(-c3cc(-c4ccc(P(=O)(c5ccccc5)c5ccccc5)cc4)cc(-c4ccc(P(=O)(c5ccccc5)c5ccccc5)cc4)c3)cc2)=CC1 |
| InChI | InChI=1S/C61H49O3P3/c1-46-27-35-58(36-28-46)67(64,57-25-15-6-16-26-57)61-41-33-49(34-42-61)52-44-50(47-29-37-59(38-30-47)65(62,53-17-7-2-8-18-53)54-19-9-3-10-20-54)43-51(45-52)48-31-39-60(40-32-48)66(63,55-21-11-4-12-22-55)56-23-13-5-14-24-56/h2-27,29-46H,28H2,1H3 |
| InChIKey | VUCWYUFMDVBKFF-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.98 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|