C18H19N2OP — CID 154098581
4-diphenylphosphorylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 154098581) has the molecular formula C18H19N2OP and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-diphenylphosphorylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-diphenylphosphorylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 154098581 |
| Molecular Formula | C18H19N2OP |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-diphenylphosphorylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(P(=O)(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H19N2OP/c19-18(20)13-11-17(12-14-18)22(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,14,19-20H2 |
| InChIKey | DUQKGBUPNBAHOH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|