C17H22N2O3 — CID 70545585
butanoic acid;(4,4-diaminocyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 70545585) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is butanoic acid;(4,4-diaminocyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | butanoic acid;(4,4-diaminocyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 70545585 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | butanoic acid;(4,4-diaminocyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | CCCC(=O)O.NC1(N)C=CC(C(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C13H14N2O.C4H8O2/c14-13(15)8-6-11(7-9-13)12(16)10-4-2-1-3-5-10;1-2-3-4(5)6/h1-8H,9,14-15H2;2-3H2,1H3,(H,5,6) |
| InChIKey | ZDWRRVOYRHOKBH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|