C20H17ClO — CID 67224165
(4-benzyl-4-chlorocyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 67224165) has the molecular formula C20H17ClO and a molecular weight of 308.81 g/mol. Its IUPAC name is (4-benzyl-4-chlorocyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | (4-benzyl-4-chlorocyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 67224165 |
| Molecular Formula | C20H17ClO |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (4-benzyl-4-chlorocyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | O=C(C1=CCC(Cl)(Cc2ccccc2)C=C1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClO/c21-20(15-16-7-3-1-4-8-16)13-11-18(12-14-20)19(22)17-9-5-2-6-10-17/h1-13H,14-15H2 |
| InChIKey | KKVBXYFFCPVJIV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|