C13H10ClFO — CID 70090183
(4-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 70090183) has the molecular formula C13H10ClFO and a molecular weight of 236.67 g/mol. Its IUPAC name is (4-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | (4-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 70090183 |
| Molecular Formula | C13H10ClFO |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (4-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | O=C(C1=CCC(F)(Cl)C=C1)c1ccccc1 |
| InChI | InChI=1S/C13H10ClFO/c14-13(15)8-6-11(7-9-13)12(16)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | KVRQLDYCHPBKMN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|