C21H19ClO — CID 174486763
[4-chloro-4-(2-phenylethyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 174486763) has the molecular formula C21H19ClO and a molecular weight of 322.84 g/mol. Its IUPAC name is [4-chloro-4-(2-phenylethyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4-chloro-4-(2-phenylethyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174486763 |
| Molecular Formula | C21H19ClO |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [4-chloro-4-(2-phenylethyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | O=C(C1=CCC(Cl)(CCc2ccccc2)C=C1)c1ccccc1 |
| InChI | InChI=1S/C21H19ClO/c22-21(14-11-17-7-3-1-4-8-17)15-12-19(13-16-21)20(23)18-9-5-2-6-10-18/h1-10,12-13,15H,11,14,16H2 |
| InChIKey | MEGFSCXKLNUIRN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|