C19H16O5 — CID 67981244
(4-benzoyl-1-prop-2-enoyloxycyclohexa-2,4-dien-1-yl) prop-2-enoate (PubChem CID 67981244) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is (4-benzoyl-1-prop-2-enoyloxycyclohexa-2,4-dien-1-yl) prop-2-enoate.
| Compound Name | (4-benzoyl-1-prop-2-enoyloxycyclohexa-2,4-dien-1-yl) prop-2-enoate |
|---|---|
| PubChem CID | 67981244 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (4-benzoyl-1-prop-2-enoyloxycyclohexa-2,4-dien-1-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(OC(=O)C=C)C=CC(C(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H16O5/c1-3-16(20)23-19(24-17(21)4-2)12-10-15(11-13-19)18(22)14-8-6-5-7-9-14/h3-12H,1-2,13H2 |
| InChIKey | JVLXTEMOMXOGSF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|