C18H15NO5 — CID 139729428
[1-nitro-4-(3-phenylprop-2-enoyl)cyclohexa-2,4-dien-1-yl] prop-2-enoate (PubChem CID 139729428) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is [1-nitro-4-(3-phenylprop-2-enoyl)cyclohexa-2,4-dien-1-yl] prop-2-enoate.
| Compound Name | [1-nitro-4-(3-phenylprop-2-enoyl)cyclohexa-2,4-dien-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 139729428 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [1-nitro-4-(3-phenylprop-2-enoyl)cyclohexa-2,4-dien-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1([N+](=O)[O-])C=CC(C(=O)C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C18H15NO5/c1-2-17(21)24-18(19(22)23)12-10-15(11-13-18)16(20)9-8-14-6-4-3-5-7-14/h2-12H,1,13H2 |
| InChIKey | UFZQOEAWENQHMH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|