About (E)-3-phenylprop-2-enamide;prop-2-enamide
(E)-3-phenylprop-2-enamide;prop-2-enamide (PubChem CID 66955302) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is (E)-3-phenylprop-2-enamide;prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-phenylprop-2-enamide;prop-2-enamide |
| PubChem CID | 66955302 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (E)-3-phenylprop-2-enamide;prop-2-enamide |
| SMILES | C=CC(N)=O.NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H9NO.C3H5NO/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-3(4)5/h1-7H,(H2,10,11);2H,1H2,(H2,4,5)/b7-6+; |
| InChIKey | OPSSROKFCPPPOE-UHDJGPCESA-N |
| XLogP | 0.84 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-phenylprop-2-enamide;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-phenylprop-2-enamide;prop-2-enamide?
The IUPAC name of (E)-3-phenylprop-2-enamide;prop-2-enamide (CID 66955302) is (E)-3-phenylprop-2-enamide;prop-2-enamide.
What is the SMILES notation for (E)-3-phenylprop-2-enamide;prop-2-enamide?
The canonical SMILES for (E)-3-phenylprop-2-enamide;prop-2-enamide is C=CC(N)=O.NC(=O)/C=C/c1ccccc1.
What is the InChIKey of (E)-3-phenylprop-2-enamide;prop-2-enamide?
The InChIKey is OPSSROKFCPPPOE-UHDJGPCESA-N. The full InChI is InChI=1S/C9H9NO.C3H5NO/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-3(4)5/h1-7H,(H2,10,11);2H,1H2,(H2,4,5)/b7-6+;.
What are the key properties of (E)-3-phenylprop-2-enamide;prop-2-enamide?
(E)-3-phenylprop-2-enamide;prop-2-enamide has a molecular weight of 218.26 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-phenylprop-2-enamide;prop-2-enamide is sourced from PubChem (CID 66955302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).