C9H9NO — CID 138396103
N,N-dideuterio-3-phenylprop-2-enamide (PubChem CID 138396103) has the molecular formula C9H9NO and a molecular weight of 149.19 g/mol. Its IUPAC name is N,N-dideuterio-3-phenylprop-2-enamide.
| Compound Name | N,N-dideuterio-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 138396103 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N,N-dideuterio-3-phenylprop-2-enamide |
| SMILES | [2H]N([2H])C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H9NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H2,10,11)/i/hD2 |
| InChIKey | APEJMQOBVMLION-ZSJDYOACSA-N |
| XLogP | 1.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|