C21H22N2O — CID 67900107
[4,4-bis[bis(ethenyl)amino]cyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 67900107) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is [4,4-bis[bis(ethenyl)amino]cyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4,4-bis[bis(ethenyl)amino]cyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 67900107 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [4,4-bis[bis(ethenyl)amino]cyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | C=CN(C=C)C1(N(C=C)C=C)C=CC(C(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C21H22N2O/c1-5-22(6-2)21(23(7-3)8-4)16-14-19(15-17-21)20(24)18-12-10-9-11-13-18/h5-16H,1-4,17H2 |
| InChIKey | IXXHCDLOSBVQOM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|