C15H14Cl2O7 — CID 160659155
bis(carbonochloridic acid);(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 160659155) has the molecular formula C15H14Cl2O7 and a molecular weight of 377.18 g/mol. Its IUPAC name is bis(carbonochloridic acid);(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | bis(carbonochloridic acid);(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 160659155 |
| Molecular Formula | C15H14Cl2O7 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | bis(carbonochloridic acid);(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | O=C(C1=CCC(O)(O)C=C1)c1ccccc1.O=C(O)Cl.O=C(O)Cl |
| InChI | InChI=1S/C13H12O3.2CHClO2/c14-12(10-4-2-1-3-5-10)11-6-8-13(15,16)9-7-11;2*2-1(3)4/h1-8,15-16H,9H2;2*(H,3,4) |
| InChIKey | RLLDKWLXPIVEFU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|