C16H16BrClO — CID 174368907
[4-(1-bromopropyl)-4-chlorocyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 174368907) has the molecular formula C16H16BrClO and a molecular weight of 339.66 g/mol. Its IUPAC name is [4-(1-bromopropyl)-4-chlorocyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4-(1-bromopropyl)-4-chlorocyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174368907 |
| Molecular Formula | C16H16BrClO |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | [4-(1-bromopropyl)-4-chlorocyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | CCC(Br)C1(Cl)C=CC(C(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H16BrClO/c1-2-14(17)16(18)10-8-13(9-11-16)15(19)12-6-4-3-5-7-12/h3-10,14H,2,11H2,1H3 |
| InChIKey | SWDBGSYIYOYHAY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|