C15H14Cl2O — CID 174479044
(4,4-dichloro-3,3-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 174479044) has the molecular formula C15H14Cl2O and a molecular weight of 281.18 g/mol. Its IUPAC name is (4,4-dichloro-3,3-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | (4,4-dichloro-3,3-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174479044 |
| Molecular Formula | C15H14Cl2O |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (4,4-dichloro-3,3-dimethylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | CC1(C)C=C(C(=O)c2ccccc2)C=CC1(Cl)Cl |
| InChI | InChI=1S/C15H14Cl2O/c1-14(2)10-12(8-9-15(14,16)17)13(18)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | DMTVSJCPAHNFQV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|