C14H12ClFO3S — CID 174392907
(3-chloro-4-fluoro-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 174392907) has the molecular formula C14H12ClFO3S and a molecular weight of 314.77 g/mol. Its IUPAC name is (3-chloro-4-fluoro-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | (3-chloro-4-fluoro-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174392907 |
| Molecular Formula | C14H12ClFO3S |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (3-chloro-4-fluoro-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | CS(=O)(=O)C1(F)C=CC(C(=O)c2ccccc2)=CC1Cl |
| InChI | InChI=1S/C14H12ClFO3S/c1-20(18,19)14(16)8-7-11(9-12(14)15)13(17)10-5-3-2-4-6-10/h2-9,12H,1H3 |
| InChIKey | BXLJIZYTPHWTLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|