C15H15ClO3S — CID 174352876
(4-chloro-2-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone (PubChem CID 174352876) has the molecular formula C15H15ClO3S and a molecular weight of 310.80 g/mol. Its IUPAC name is (4-chloro-2-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone.
| Compound Name | (4-chloro-2-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174352876 |
| Molecular Formula | C15H15ClO3S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (4-chloro-2-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-yl)-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C=CC(Cl)(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H15ClO3S/c1-11-10-15(16,20(2,18)19)9-8-13(11)14(17)12-6-4-3-5-7-12/h3-9H,10H2,1-2H3 |
| InChIKey | CIMFNEWQRKMKGP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|