C19H15ClN2O3 — CID 174392923
[4-chloro-4-(2-nitroanilino)cyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 174392923) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is [4-chloro-4-(2-nitroanilino)cyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4-chloro-4-(2-nitroanilino)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174392923 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [4-chloro-4-(2-nitroanilino)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | O=C(C1=CCC(Cl)(Nc2ccccc2[N+](=O)[O-])C=C1)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O3/c20-19(21-16-8-4-5-9-17(16)22(24)25)12-10-15(11-13-19)18(23)14-6-2-1-3-7-14/h1-12,21H,13H2 |
| InChIKey | NUSGVKSHKGGSKH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|