About bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine
bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine (PubChem CID 67839586) has the molecular formula C19H17N3O5
and a molecular weight of 367.36 g/mol. Its IUPAC name is bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine.
Molecular Properties
| Compound Name | bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine |
| PubChem CID | 67839586 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine |
| SMILES | NNc1ccccc1[N+](=O)[O-].O=C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H10O3.C6H7N3O2/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10;7-8-5-3-1-2-4-6(5)9(10)11/h1-8,14-15H;1-4,8H,7H2 |
| InChIKey | IINXCOPSWUHPHU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine?
The IUPAC name of bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine (CID 67839586) is bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine.
What is the SMILES notation for bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine?
The canonical SMILES for bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine is NNc1ccccc1[N+](=O)[O-].O=C(c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine?
The InChIKey is IINXCOPSWUHPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C6H7N3O2/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10;7-8-5-3-1-2-4-6(5)9(10)11/h1-8,14-15H;1-4,8H,7H2.
What are the key properties of bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine?
bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine has a molecular weight of 367.36 g/mol, XLogP of 3.21, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxyphenyl)methanone;(2-nitrophenyl)hydrazine is sourced from PubChem (CID 67839586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).