C25H24N2O3 — CID 134362905
bis(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)methanone (PubChem CID 134362905) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is bis(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)methanone.
| Compound Name | bis(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)methanone |
|---|---|
| PubChem CID | 134362905 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | bis(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)methanone |
| SMILES | NC1(Oc2ccccc2)C=CC(C(=O)C2=CCC(N)(Oc3ccccc3)C=C2)=CC1 |
| InChI | InChI=1S/C25H24N2O3/c26-24(29-21-7-3-1-4-8-21)15-11-19(12-16-24)23(28)20-13-17-25(27,18-14-20)30-22-9-5-2-6-10-22/h1-15,17H,16,18,26-27H2 |
| InChIKey | LXIMRYHSONQUNB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|