C27H21NO2 — CID 68629016
[4-(3-aminophenoxy)-4-(2-phenylethynyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 68629016) has the molecular formula C27H21NO2 and a molecular weight of 391.47 g/mol. Its IUPAC name is [4-(3-aminophenoxy)-4-(2-phenylethynyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4-(3-aminophenoxy)-4-(2-phenylethynyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 68629016 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [4-(3-aminophenoxy)-4-(2-phenylethynyl)cyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | Nc1cccc(OC2(C#Cc3ccccc3)C=CC(C(=O)c3ccccc3)=CC2)c1 |
| InChI | InChI=1S/C27H21NO2/c28-24-12-7-13-25(20-24)30-27(17-14-21-8-3-1-4-9-21)18-15-23(16-19-27)26(29)22-10-5-2-6-11-22/h1-13,15-16,18,20H,19,28H2 |
| InChIKey | KHMAATLFUCNCLJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|