C29H32N2O3 — CID 175245345
bis[4-(aminomethyl)-4-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]methanone (PubChem CID 175245345) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is bis[4-(aminomethyl)-4-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]methanone.
| Compound Name | bis[4-(aminomethyl)-4-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]methanone |
|---|---|
| PubChem CID | 175245345 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | bis[4-(aminomethyl)-4-(4-methoxyphenyl)cyclohexa-1,5-dien-1-yl]methanone |
| SMILES | COc1ccc(C2(CN)C=CC(C(=O)C3=CCC(CN)(c4ccc(OC)cc4)C=C3)=CC2)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-33-25-7-3-23(4-8-25)28(19-30)15-11-21(12-16-28)27(32)22-13-17-29(20-31,18-14-22)24-5-9-26(34-2)10-6-24/h3-15,17H,16,18-20,30-31H2,1-2H3 |
| InChIKey | KUJIFPLHUUTBCI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |