C14H16O2 — CID 141234694
[(1S)-1-(4-methoxyphenyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 141234694) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is [(1S)-1-(4-methoxyphenyl)cyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [(1S)-1-(4-methoxyphenyl)cyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 141234694 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | [(1S)-1-(4-methoxyphenyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | COc1ccc([C@@]2(CO)C=CC=CC2)cc1 |
| InChI | InChI=1S/C14H16O2/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h2-9,15H,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | ZJAPABDBUUCGJP-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |