C14H15Cl — CID 151274526
1-chloro-4-(1-ethylcyclohexa-2,4-dien-1-yl)benzene (PubChem CID 151274526) has the molecular formula C14H15Cl and a molecular weight of 218.73 g/mol. Its IUPAC name is 1-chloro-4-(1-ethylcyclohexa-2,4-dien-1-yl)benzene.
| Compound Name | 1-chloro-4-(1-ethylcyclohexa-2,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 151274526 |
| Molecular Formula | C14H15Cl |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-chloro-4-(1-ethylcyclohexa-2,4-dien-1-yl)benzene |
| SMILES | CCC1(c2ccc(Cl)cc2)C=CC=CC1 |
| InChI | InChI=1S/C14H15Cl/c1-2-14(10-4-3-5-11-14)12-6-8-13(15)9-7-12/h3-10H,2,11H2,1H3 |
| InChIKey | NXBSMEXUWWGQOL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |