C12H15ClN2 — CID 141332979
(3S)-3-(4-chlorophenyl)-3-ethyl-1,2-dihydropyrrol-5-amine (PubChem CID 141332979) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-3-ethyl-1,2-dihydropyrrol-5-amine.
| Compound Name | (3S)-3-(4-chlorophenyl)-3-ethyl-1,2-dihydropyrrol-5-amine |
|---|---|
| PubChem CID | 141332979 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-3-ethyl-1,2-dihydropyrrol-5-amine |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2)C=C(N)NC1 |
| InChI | InChI=1S/C12H15ClN2/c1-2-12(7-11(14)15-8-12)9-3-5-10(13)6-4-9/h3-7,15H,2,8,14H2,1H3/t12-/m1/s1 |
| InChIKey | HZVKJYDASJJVDP-GFCCVEGCSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |