C17H26ClN — CID 91613724
acetylene;1-[1-(4-chlorophenyl)cyclobutyl]ethanamine;propane (PubChem CID 91613724) has the molecular formula C17H26ClN and a molecular weight of 279.85 g/mol. Its IUPAC name is acetylene;1-[1-(4-chlorophenyl)cyclobutyl]ethanamine;propane.
| Compound Name | acetylene;1-[1-(4-chlorophenyl)cyclobutyl]ethanamine;propane |
|---|---|
| PubChem CID | 91613724 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.85 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | acetylene;1-[1-(4-chlorophenyl)cyclobutyl]ethanamine;propane |
| SMILES | C#C.CC(N)C1(c2ccc(Cl)cc2)CCC1.CCC |
| InChI | InChI=1S/C12H16ClN.C3H8.C2H2/c1-9(14)12(7-2-8-12)10-3-5-11(13)6-4-10;1-3-2;1-2/h3-6,9H,2,7-8,14H2,1H3;3H2,1-2H3;1-2H |
| InChIKey | ZTQVGGAVDWFQED-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|