C17H26ClSe+ — CID 154066802
[(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]-dimethylselanium (PubChem CID 154066802) has the molecular formula C17H26ClSe+ and a molecular weight of 344.81 g/mol. Its IUPAC name is [(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]-dimethylselanium.
| Compound Name | [(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]-dimethylselanium |
|---|---|
| PubChem CID | 154066802 |
| Molecular Formula | C17H26ClSe+ |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]-dimethylselanium |
| SMILES | CC(C)C[C@@H]([Se+](C)C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C17H26ClSe/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14/h6-9,13,16H,5,10-12H2,1-4H3/q+1/t16-/m1/s1 |
| InChIKey | KQUNPFFIQMSYIN-MRXNPFEDSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|