About 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane
1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane (PubChem CID 142145945) has the molecular formula C19H32ClN
and a molecular weight of 309.93 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane.
Molecular Properties
| Compound Name | 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane |
| PubChem CID | 142145945 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.93 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane |
| SMILES | CC.CNC(CC(C)C)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C17H26ClN.C2H6/c1-13(2)12-16(19-3)17(10-4-5-11-17)14-6-8-15(18)9-7-14;1-2/h6-9,13,16,19H,4-5,10-12H2,1-3H3;1-2H3 |
| InChIKey | NOEHSDIELVUGBR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane?
The IUPAC name of 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane (CID 142145945) is 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane.
What is the SMILES notation for 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane?
The canonical SMILES for 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane is CC.CNC(CC(C)C)C1(c2ccc(Cl)cc2)CCCC1.
What is the InChIKey of 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane?
The InChIKey is NOEHSDIELVUGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClN.C2H6/c1-13(2)12-16(19-3)17(10-4-5-11-17)14-6-8-15(18)9-7-14;1-2/h6-9,13,16,19H,4-5,10-12H2,1-3H3;1-2H3.
What are the key properties of 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane?
1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane has a molecular weight of 309.93 g/mol, XLogP of 5.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-chlorophenyl)cyclopentyl]-N,3-dimethylbutan-1-amine;ethane is sourced from PubChem (CID 142145945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).