C21H32ClNO2 — CID 56596094
2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate (PubChem CID 56596094) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate.
| Compound Name | 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 56596094 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate |
| SMILES | CC(C)CC(NCCOC(=O)C(C)C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C21H32ClNO2/c1-15(2)14-19(23-12-13-25-20(24)16(3)4)21(10-5-11-21)17-6-8-18(22)9-7-17/h6-9,15-16,19,23H,5,10-14H2,1-4H3 |
| InChIKey | RZRYHCGRLJQPDS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|