C21H31Cl2NO2 — CID 56596195
2-[[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate (PubChem CID 56596195) has the molecular formula C21H31Cl2NO2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-[[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate.
| Compound Name | 2-[[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 56596195 |
| Molecular Formula | C21H31Cl2NO2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-methylbutyl]amino]ethyl 2-methylpropanoate |
| SMILES | CC(C)CC(NCCOC(=O)C(C)C)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C21H31Cl2NO2/c1-14(2)12-19(24-10-11-26-20(25)15(3)4)21(8-5-9-21)16-6-7-17(22)18(23)13-16/h6-7,13-15,19,24H,5,8-12H2,1-4H3 |
| InChIKey | VANHSVIGEQBERV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|