C23H38N2O2 — CID 66824346
4-[[1-[1-(4-ethoxyphenyl)cyclobutyl]-3-methylbutyl]amino]-2-ethylbutanamide (PubChem CID 66824346) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 4-[[1-[1-(4-ethoxyphenyl)cyclobutyl]-3-methylbutyl]amino]-2-ethylbutanamide.
| Compound Name | 4-[[1-[1-(4-ethoxyphenyl)cyclobutyl]-3-methylbutyl]amino]-2-ethylbutanamide |
|---|---|
| PubChem CID | 66824346 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 4-[[1-[1-(4-ethoxyphenyl)cyclobutyl]-3-methylbutyl]amino]-2-ethylbutanamide |
| SMILES | CCOc1ccc(C2(C(CC(C)C)NCCC(CC)C(N)=O)CCC2)cc1 |
| InChI | InChI=1S/C23H38N2O2/c1-5-18(22(24)26)12-15-25-21(16-17(3)4)23(13-7-14-23)19-8-10-20(11-9-19)27-6-2/h8-11,17-18,21,25H,5-7,12-16H2,1-4H3,(H2,24,26) |
| InChIKey | RRSIWRGSIWQQEV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |