C19H29NO3 — CID 59741474
ethyl 2-[4-[1-(1-amino-3-methylbutyl)cyclobutyl]phenoxy]acetate (PubChem CID 59741474) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is ethyl 2-[4-[1-(1-amino-3-methylbutyl)cyclobutyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[1-(1-amino-3-methylbutyl)cyclobutyl]phenoxy]acetate |
|---|---|
| PubChem CID | 59741474 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | ethyl 2-[4-[1-(1-amino-3-methylbutyl)cyclobutyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2(C(N)CC(C)C)CCC2)cc1 |
| InChI | InChI=1S/C19H29NO3/c1-4-22-18(21)13-23-16-8-6-15(7-9-16)19(10-5-11-19)17(20)12-14(2)3/h6-9,14,17H,4-5,10-13,20H2,1-3H3 |
| InChIKey | VVLDBXNYEOHFFZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |