C22H34ClNO2 — CID 25050587
ethyl 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]pentanoate (PubChem CID 25050587) has the molecular formula C22H34ClNO2 and a molecular weight of 379.97 g/mol. Its IUPAC name is ethyl 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]pentanoate.
| Compound Name | ethyl 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]pentanoate |
|---|---|
| PubChem CID | 25050587 |
| Molecular Formula | C22H34ClNO2 |
| Molecular Weight | 379.97 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | ethyl 2-[[1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutyl]amino]pentanoate |
| SMILES | CCCC(NC(CC(C)C)C1(c2ccc(Cl)cc2)CCC1)C(=O)OCC |
| InChI | InChI=1S/C22H34ClNO2/c1-5-8-19(21(25)26-6-2)24-20(15-16(3)4)22(13-7-14-22)17-9-11-18(23)12-10-17/h9-12,16,19-20,24H,5-8,13-15H2,1-4H3 |
| InChIKey | DBSMDHFZYINHEW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |