C21H36ClN — CID 143085896
3-[1-(4-chlorophenyl)cyclobutyl]-5-methylhexan-1-amine;2-methylpropane (PubChem CID 143085896) has the molecular formula C21H36ClN and a molecular weight of 337.98 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)cyclobutyl]-5-methylhexan-1-amine;2-methylpropane.
| Compound Name | 3-[1-(4-chlorophenyl)cyclobutyl]-5-methylhexan-1-amine;2-methylpropane |
|---|---|
| PubChem CID | 143085896 |
| Molecular Formula | C21H36ClN |
| Molecular Weight | 337.98 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 3-[1-(4-chlorophenyl)cyclobutyl]-5-methylhexan-1-amine;2-methylpropane |
| SMILES | CC(C)C.CC(C)CC(CCN)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C17H26ClN.C4H10/c1-13(2)12-15(8-11-19)17(9-3-10-17)14-4-6-16(18)7-5-14;1-4(2)3/h4-7,13,15H,3,8-12,19H2,1-2H3;4H,1-3H3 |
| InChIKey | MSKXJQJNRJHQOD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.98 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |