C14H20ClN — CID 174659532
3-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropan-1-amine (PubChem CID 174659532) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropan-1-amine.
| Compound Name | 3-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 174659532 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropan-1-amine |
| SMILES | CC(CN)CC1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C14H20ClN/c1-11(10-16)9-14(7-2-8-14)12-3-5-13(15)6-4-12/h3-6,11H,2,7-10,16H2,1H3 |
| InChIKey | ZRRSXNMZXWGCJP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |