About 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride
4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride (PubChem CID 69304082) has the molecular formula C17H29Cl2NO
and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride |
| PubChem CID | 69304082 |
| Molecular Formula | C17H29Cl2NO |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride |
| SMILES | CC(CCN(C)C)CC1(c2ccc(Cl)cc2)CCC1.Cl.O |
| InChI | InChI=1S/C17H26ClN.ClH.H2O/c1-14(9-12-19(2)3)13-17(10-4-11-17)15-5-7-16(18)8-6-15;;/h5-8,14H,4,9-13H2,1-3H3;1H;1H2 |
| InChIKey | IOXRXQUNKFTKAS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride?
The IUPAC name of 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride (CID 69304082) is 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride.
What is the SMILES notation for 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride?
The canonical SMILES for 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride is CC(CCN(C)C)CC1(c2ccc(Cl)cc2)CCC1.Cl.O.
What is the InChIKey of 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride?
The InChIKey is IOXRXQUNKFTKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClN.ClH.H2O/c1-14(9-12-19(2)3)13-17(10-4-11-17)15-5-7-16(18)8-6-15;;/h5-8,14H,4,9-13H2,1-3H3;1H;1H2.
What are the key properties of 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride?
4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride has a molecular weight of 334.33 g/mol, XLogP of 4.34, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrate;hydrochloride is sourced from PubChem (CID 69304082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).