C17H25Cl2N — CID 23292613
N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-N-methylcyclopentanamine;hydrochloride (PubChem CID 23292613) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-N-methylcyclopentanamine;hydrochloride.
| Compound Name | N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-N-methylcyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 23292613 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-N-methylcyclopentanamine;hydrochloride |
| SMILES | CN(CC1(c2ccc(Cl)cc2)CCC1)C1CCCC1.Cl |
| InChI | InChI=1S/C17H24ClN.ClH/c1-19(16-5-2-3-6-16)13-17(11-4-12-17)14-7-9-15(18)10-8-14;/h7-10,16H,2-6,11-13H2,1H3;1H |
| InChIKey | IADQRMHJLUKPCP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |