C17H25ClIN3 — CID 110030573
2-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide (PubChem CID 110030573) has the molecular formula C17H25ClIN3 and a molecular weight of 433.77 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030573 |
| Molecular Formula | C17H25ClIN3 |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CC1(c2ccc(Cl)cc2)CCCC1)C1CC1.I |
| InChI | InChI=1S/C17H24ClN3.HI/c1-21(15-8-9-15)16(19)20-12-17(10-2-3-11-17)13-4-6-14(18)7-5-13;/h4-7,15H,2-3,8-12H2,1H3,(H2,19,20);1H |
| InChIKey | DOCMEWWNDPCOBV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|