C15H20ClFIN3 — CID 110031853
2-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide (PubChem CID 110031853) has the molecular formula C15H20ClFIN3 and a molecular weight of 423.70 g/mol. Its IUPAC name is 2-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110031853 |
| Molecular Formula | C15H20ClFIN3 |
| Molecular Weight | 423.70 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 2-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CC1(c2ccc(F)cc2Cl)CC1)C1CC1.I |
| InChI | InChI=1S/C15H19ClFN3.HI/c1-20(11-3-4-11)14(18)19-9-15(6-7-15)12-5-2-10(17)8-13(12)16;/h2,5,8,11H,3-4,6-7,9H2,1H3,(H2,18,19);1H |
| InChIKey | KJKMYDZEAKSTCA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|