C11H15ClIN3 — CID 110935474
2-[[1-(4-chlorophenyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 110935474) has the molecular formula C11H15ClIN3 and a molecular weight of 351.62 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110935474 |
| Molecular Formula | C11H15ClIN3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCC1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C11H14ClN3.HI/c12-9-3-1-8(2-4-9)11(5-6-11)7-15-10(13)14;/h1-4H,5-7H2,(H4,13,14,15);1H |
| InChIKey | QQCJMUGPXJEGBX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|