C14H16O — CID 141234682
[(1S)-1-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 141234682) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is [(1S)-1-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [(1S)-1-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 141234682 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(1S)-1-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | Cc1ccc([C@@]2(CO)C=CC=CC2)cc1 |
| InChI | InChI=1S/C14H16O/c1-12-5-7-13(8-6-12)14(11-15)9-3-2-4-10-14/h2-9,15H,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | QBTUXXZAXRCDHF-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |