C14H17N — CID 141124285
2-(1-phenylcyclohexa-2,4-dien-1-yl)ethanamine (PubChem CID 141124285) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(1-phenylcyclohexa-2,4-dien-1-yl)ethanamine.
| Compound Name | 2-(1-phenylcyclohexa-2,4-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 141124285 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-(1-phenylcyclohexa-2,4-dien-1-yl)ethanamine |
| SMILES | NCCC1(c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C14H17N/c15-12-11-14(9-5-2-6-10-14)13-7-3-1-4-8-13/h1-9H,10-12,15H2 |
| InChIKey | BJVVIWHCZCAPKQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |