C13H14F3N — CID 158788538
difluoromethanamine;(1-fluorocyclohexa-2,4-dien-1-yl)benzene (PubChem CID 158788538) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is difluoromethanamine;(1-fluorocyclohexa-2,4-dien-1-yl)benzene.
| Compound Name | difluoromethanamine;(1-fluorocyclohexa-2,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 158788538 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | difluoromethanamine;(1-fluorocyclohexa-2,4-dien-1-yl)benzene |
| SMILES | FC1(c2ccccc2)C=CC=CC1.NC(F)F |
| InChI | InChI=1S/C12H11F.CH3F2N/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;2-1(3)4/h1-9H,10H2;1H,4H2 |
| InChIKey | IRZGCFLJNVKDJO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|