C20H22O2 — CID 159421128
ethane;4-[1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]phenol (PubChem CID 159421128) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethane;4-[1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]phenol.
| Compound Name | ethane;4-[1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]phenol |
|---|---|
| PubChem CID | 159421128 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethane;4-[1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]phenol |
| SMILES | CC.Oc1ccc(C2(c3ccc(O)cc3)C=CC=CC2)cc1 |
| InChI | InChI=1S/C18H16O2.C2H6/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;1-2/h1-12,19-20H,13H2;1-2H3 |
| InChIKey | LPTXSFNAYMRYCQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |