C17H16O — CID 175313272
(1-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 175313272) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is (1-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)methanol.
| Compound Name | (1-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)methanol |
|---|---|
| PubChem CID | 175313272 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (1-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)methanol |
| SMILES | OCC1(c2cccc3ccccc23)C=CC=CC1 |
| InChI | InChI=1S/C17H16O/c18-13-17(11-4-1-5-12-17)16-10-6-8-14-7-2-3-9-15(14)16/h1-11,18H,12-13H2 |
| InChIKey | ZWTPQTVIUXCRBS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |