About 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline
1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline (PubChem CID 174464915) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline.
Molecular Properties
| Compound Name | 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline |
| PubChem CID | 174464915 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline |
| SMILES | C=CCC1(c2nccc3ccccc23)C=CC=CC1 |
| InChI | InChI=1S/C18H17N/c1-2-11-18(12-6-3-7-13-18)17-16-9-5-4-8-15(16)10-14-19-17/h2-10,12,14H,1,11,13H2 |
| InChIKey | NMUKHHMWTMYTID-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline?
The IUPAC name of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline (CID 174464915) is 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline.
What is the SMILES notation for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline?
The canonical SMILES for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline is C=CCC1(c2nccc3ccccc23)C=CC=CC1.
What is the InChIKey of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline?
The InChIKey is NMUKHHMWTMYTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-2-11-18(12-6-3-7-13-18)17-16-9-5-4-8-15(16)10-14-19-17/h2-10,12,14H,1,11,13H2.
What are the key properties of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline?
1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline has a molecular weight of 247.34 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)isoquinoline is sourced from PubChem (CID 174464915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).