C13H15N — CID 175315625
2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]pyridine (PubChem CID 175315625) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]pyridine.
| Compound Name | 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]pyridine |
|---|---|
| PubChem CID | 175315625 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]pyridine |
| SMILES | CC[C@]1(c2ccccn2)C=CC=CC1 |
| InChI | InChI=1S/C13H15N/c1-2-13(9-5-3-6-10-13)12-8-4-7-11-14-12/h3-9,11H,2,10H2,1H3/t13-/m0/s1 |
| InChIKey | BFUBUPNQBTYAJS-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |