C14H18N2 — CID 80521385
3,3-diethyl-1-pyridin-2-ylcyclobutane-1-carbonitrile (PubChem CID 80521385) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3,3-diethyl-1-pyridin-2-ylcyclobutane-1-carbonitrile.
| Compound Name | 3,3-diethyl-1-pyridin-2-ylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 80521385 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3,3-diethyl-1-pyridin-2-ylcyclobutane-1-carbonitrile |
| SMILES | CCC1(CC)CC(C#N)(c2ccccn2)C1 |
| InChI | InChI=1S/C14H18N2/c1-3-13(4-2)9-14(10-13,11-15)12-7-5-6-8-16-12/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | WAOQFTHMUDKOOM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |