C19H23N3Si — CID 11578367
(2,6-dipyridin-2-yl-1H-pyridin-2-yl)methyl-trimethylsilane (PubChem CID 11578367) has the molecular formula C19H23N3Si and a molecular weight of 321.50 g/mol. Its IUPAC name is (2,6-dipyridin-2-yl-1H-pyridin-2-yl)methyl-trimethylsilane.
| Compound Name | (2,6-dipyridin-2-yl-1H-pyridin-2-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 11578367 |
| Molecular Formula | C19H23N3Si |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2,6-dipyridin-2-yl-1H-pyridin-2-yl)methyl-trimethylsilane |
| SMILES | C[Si](C)(C)CC1(c2ccccn2)C=CC=C(c2ccccn2)N1 |
| InChI | InChI=1S/C19H23N3Si/c1-23(2,3)15-19(18-11-5-7-14-21-18)12-8-10-17(22-19)16-9-4-6-13-20-16/h4-14,22H,15H2,1-3H3 |
| InChIKey | GVWGBLXKIZULGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|