C14H14O3 — CID 152749301
4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 152749301) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 152749301 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | COC1(c2ccccc2)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C14H14O3/c1-17-14(12-5-3-2-4-6-12)9-7-11(8-10-14)13(15)16/h2-9H,10H2,1H3,(H,15,16) |
| InChIKey | NYZSNDIKIFNCRM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |