4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid

C14H14O3 — CID 152749301

IUPAC4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid
SMILESCOC1(c2ccccc2)C=CC(C(=O)O)=CC1
InChIInChI=1S/C14H14O3/c1-17-14(12-5-3-2-4-6-12)9-7-11(8-10-14)13(15)16/h2-9H,10H2,1H3,(H,15,16)
InChIKeyNYZSNDIKIFNCRM-UHFFFAOYSA-N
MW230.26 g/mol
LogP2.50
Rot. Bonds3

About 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid

4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 152749301) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid
PubChem CID152749301
Molecular FormulaC14H14O3
Molecular Weight230.26 g/mol
Exact Mass230.09
IUPAC Name4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid
SMILESCOC1(c2ccccc2)C=CC(C(=O)O)=CC1
InChIInChI=1S/C14H14O3/c1-17-14(12-5-3-2-4-6-12)9-7-11(8-10-14)13(15)16/h2-9H,10H2,1H3,(H,15,16)
InChIKeyNYZSNDIKIFNCRM-UHFFFAOYSA-N
XLogP2.50
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid (CID 152749301) is 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid is COC1(c2ccccc2)C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is NYZSNDIKIFNCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3/c1-17-14(12-5-3-2-4-6-12)9-7-11(8-10-14)13(15)16/h2-9H,10H2,1H3,(H,15,16).
What are the key properties of 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid?
4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 230.26 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-phenylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 152749301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).